EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H37NO2 |
| Net Charge | 0 |
| Average Mass | 347.543 |
| Monoisotopic Mass | 347.28243 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCO |
| InChI | InChI=1S/C22H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)23-20-21-24/h6-7,9-10,12-13,15-16,24H,2-5,8,11,14,17-21H2,1H3,(H,23,25)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | LGEQQWMQCRIYKG-DOFZRALJSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | DOI (10.1038/nbt.2488) | ||
| blood (UBERON:0000178) | PubMed (16118355) | ||
| cerebrospinal fluid (UBERON:0001359) | PubMed (19817812) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. neurotransmitter An endogenous compound that is used to transmit information across the synapse between a neuron and another cell. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| Application: | vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anandamide (CHEBI:2700) has functional parent arachidonic acid (CHEBI:15843) |
| anandamide (CHEBI:2700) has role human blood serum metabolite (CHEBI:85234) |
| anandamide (CHEBI:2700) has role neurotransmitter (CHEBI:25512) |
| anandamide (CHEBI:2700) has role vasodilator agent (CHEBI:35620) |
| anandamide (CHEBI:2700) is a N-acylethanolamine 20:4 (CHEBI:134161) |
| anandamide (CHEBI:2700) is a endocannabinoid (CHEBI:67197) |
| Incoming Relation(s) |
| N-(20-hydroxyarachidonoyl)ethanolamine (CHEBI:136992) has functional parent anandamide (CHEBI:2700) |
| N-[(5Z,11Z,14Z)-8,9-epoxyicosatrienoyl]ethanolamine (CHEBI:136989) has functional parent anandamide (CHEBI:2700) |
| N-[(5Z,8Z,11Z)-14,15-epoxyicosatrienoyl]ethanolamine (CHEBI:136991) has functional parent anandamide (CHEBI:2700) |
| N-[(5Z,8Z,14Z)-11,12-epoxyicosatrienoyl]ethanolamine (CHEBI:136990) has functional parent anandamide (CHEBI:2700) |
| N-[(8Z,11Z,14Z)-5,6-epoxyicosatrienoyl]ethanolamine (CHEBI:136988) has functional parent anandamide (CHEBI:2700) |
| N-arachidonoylethanolamine phosphate(2−) (CHEBI:131894) has functional parent anandamide (CHEBI:2700) |
| O-oleoylanandamide (CHEBI:76070) has functional parent anandamide (CHEBI:2700) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,14Z)-N-(2-hydroxyethyl)icosa-5,8,11,14-tetraenamide |
| Synonyms | Source |
|---|---|
| (5Z,8Z,11Z,14Z)-N-(2-hydroxyethyl)-5,8,11,14-eicosatetraenamide | ChemIDplus |
| AEA | KEGG COMPOUND |
| Anandamide | KEGG COMPOUND |
| Anandamide (20.4, N-6) | HMDB |
| Anandamide(20:4, N-6) | HMDB |
| Arachidonic acid N-(hydroxyethyl)amide | HMDB |
| UniProt Name | Source |
|---|---|
| N-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-ethanolamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4445241 | ChemSpider |
| Anandamide | Wikipedia |
| C11695 | KEGG COMPOUND |
| CPD-7598 | MetaCyc |
| E7Y | PDBeChem |
| FDB023303 | FooDB |
| HMDB0004080 | HMDB |
| LMFA08040001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7079463 | Reaxys |
| CAS:94421-68-8 | ChemIDplus |
| CAS:94421-68-8 | KEGG COMPOUND |
| Citations |
|---|