EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H37NO3 |
| Net Charge | 0 |
| Average Mass | 363.542 |
| Monoisotopic Mass | 363.27734 |
| SMILES | CCCCC/C=C\CC1OC1C/C=C\C/C=C\CCCC(=O)NCCO |
| InChI | InChI=1S/C22H37NO3/c1-2-3-4-5-9-12-15-20-21(26-20)16-13-10-7-6-8-11-14-17-22(25)23-18-19-24/h6,8-10,12-13,20-21,24H,2-5,7,11,14-19H2,1H3,(H,23,25)/b8-6-,12-9-,13-10- |
| InChIKey | TYRRSRADDAROSO-KROJNAHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21689782) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(5Z,8Z,14Z)-11,12-epoxyicosatrienoyl]ethanolamine (CHEBI:136990) has functional parent 11,12-EET (CHEBI:34130) |
| N-[(5Z,8Z,14Z)-11,12-epoxyicosatrienoyl]ethanolamine (CHEBI:136990) has functional parent anandamide (CHEBI:2700) |
| N-[(5Z,8Z,14Z)-11,12-epoxyicosatrienoyl]ethanolamine (CHEBI:136990) has role human xenobiotic metabolite (CHEBI:76967) |
| N-[(5Z,8Z,14Z)-11,12-epoxyicosatrienoyl]ethanolamine (CHEBI:136990) is a N-(long-chain-acyl)ethanolamine (CHEBI:15897) |
| N-[(5Z,8Z,14Z)-11,12-epoxyicosatrienoyl]ethanolamine (CHEBI:136990) is a N-(polyunsaturated fatty acyl)ethanolamine (CHEBI:85281) |
| N-[(5Z,8Z,14Z)-11,12-epoxyicosatrienoyl]ethanolamine (CHEBI:136990) is a endocannabinoid (CHEBI:67197) |
| N-[(5Z,8Z,14Z)-11,12-epoxyicosatrienoyl]ethanolamine (CHEBI:136990) is a epoxide (CHEBI:32955) |
| N-[(5Z,8Z,14Z)-11,12-epoxyicosatrienoyl]ethanolamine (CHEBI:136990) is a oxidized N-(fatty acyl)-ethanolamine (CHEBI:167118) |
| IUPAC Name |
|---|
| (5Z,8Z)-N-(2-hydroxyethyl)-10-{3-[(2Z)-oct-2-en-1-yl]oxiran-2-yl}deca-5,8-dienamide |
| Synonyms | Source |
|---|---|
| 11,12-EET-EA | ChEBI |
| 11(12)-EET-EA | SUBMITTER |
| 11(12)-EpETrE-EA | LIPID MAPS |
| N-(11,12-epoxy-5Z,8Z,14Z-icosatrienoyl)ethanolamine | ChEBI |
| UniProt Name | Source |
|---|---|
| N-(11,12-epoxy-5Z,8Z,14Z-eicosatrienoyl)-ethanolamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013652 | HMDB |
| LMFA08040034 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11069011 | Reaxys |
| Citations |
|---|