EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36O3 |
| Net Charge | 0 |
| Average Mass | 348.527 |
| Monoisotopic Mass | 348.26645 |
| SMILES | CCCCCCCCCCCCCCCc1cccc(O)c1C(=O)O |
| InChI | InChI=1S/C22H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h15,17-18,23H,2-14,16H2,1H3,(H,24,25) |
| InChIKey | ADFWQBGTDJIESE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amphipterygium adstringens (ncbitaxon:124857) | - | PubMed (26371858) | |
| Anacardium occidentale (ncbitaxon:171929) | - | PubMed (32995295 ) | |
| Semecarpus anacardium (ncbitaxon:289767) | - | PubMed (34588850) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.3.1.48 (histone acetyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the function of histone acetyltransferase (EC 2.3.1.48). EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anacardic acid (CHEBI:2696) has functional parent salicylic acid (CHEBI:16914) |
| anacardic acid (CHEBI:2696) has role anti-inflammatory agent (CHEBI:67079) |
| anacardic acid (CHEBI:2696) has role antibacterial agent (CHEBI:33282) |
| anacardic acid (CHEBI:2696) has role anticoronaviral agent (CHEBI:149553) |
| anacardic acid (CHEBI:2696) has role apoptosis inducer (CHEBI:68495) |
| anacardic acid (CHEBI:2696) has role EC 2.3.1.48 (histone acetyltransferase) inhibitor (CHEBI:76395) |
| anacardic acid (CHEBI:2696) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| anacardic acid (CHEBI:2696) has role neuroprotective agent (CHEBI:63726) |
| anacardic acid (CHEBI:2696) has role plant metabolite (CHEBI:76924) |
| anacardic acid (CHEBI:2696) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| anacardic acid (CHEBI:2696) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 2-hydroxy-6-pentadecylbenzoic acid |
| Synonyms | Source |
|---|---|
| (15:0)-anacardic acid | ChEBI |
| 1-hydroxy-2-carboxy-3-pentadecylbenzene | ChEBI |
| 22:0-anacardic acid | ChEBI |
| 6-pentadecyl-2-hydroxybenzoic acid | ChEBI |
| 6-pentadecylsalicylic acid | ChEBI |
| 6-(pentadecyl)salicylic acid | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:16611-84-0 | ChemIDplus |
| Citations |
|---|