EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36O3 |
| Net Charge | 0 |
| Average Mass | 348.527 |
| Monoisotopic Mass | 348.26645 |
| SMILES | CCCCCCCCCCCCCCCc1cccc(O)c1C(=O)O |
| InChI | InChI=1S/C22H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h15,17-18,23H,2-14,16H2,1H3,(H,24,25) |
| InChIKey | ADFWQBGTDJIESE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Semecarpus anacardium (ncbitaxon:289767) | - | PubMed (34588850) | |
| Amphipterygium adstringens (ncbitaxon:124857) | - | PubMed (26371858) | |
| Anacardium occidentale (ncbitaxon:171929) | - | PubMed (32995295 ) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). EC 2.3.1.48 (histone acetyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the function of histone acetyltransferase (EC 2.3.1.48). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anacardic acid (CHEBI:2696) has functional parent salicylic acid (CHEBI:16914) |
| anacardic acid (CHEBI:2696) has role anti-inflammatory agent (CHEBI:67079) |
| anacardic acid (CHEBI:2696) has role antibacterial agent (CHEBI:33282) |
| anacardic acid (CHEBI:2696) has role anticoronaviral agent (CHEBI:149553) |
| anacardic acid (CHEBI:2696) has role apoptosis inducer (CHEBI:68495) |
| anacardic acid (CHEBI:2696) has role EC 2.3.1.48 (histone acetyltransferase) inhibitor (CHEBI:76395) |
| anacardic acid (CHEBI:2696) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| anacardic acid (CHEBI:2696) has role neuroprotective agent (CHEBI:63726) |
| anacardic acid (CHEBI:2696) has role plant metabolite (CHEBI:76924) |
| anacardic acid (CHEBI:2696) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| anacardic acid (CHEBI:2696) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 2-hydroxy-6-pentadecylbenzoic acid |
| Synonyms | Source |
|---|---|
| 1-hydroxy-2-carboxy-3-pentadecylbenzene | ChEBI |
| (15:0)-anacardic acid | ChEBI |
| cyclogallipharic acid | ChEBI |
| hydroginkgolic acid | ChEBI |
| 22:0-anacardic acid | ChEBI |
| 6-pentadecyl-2-hydroxybenzoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:16611-84-0 | ChemIDplus |
| Citations |
|---|