EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24N2O8 |
| Net Charge | 0 |
| Average Mass | 444.440 |
| Monoisotopic Mass | 444.15327 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)cccc1[C@@]2(C)O |
| InChI | InChI=1S/C22H24N2O8/c1-21(31)8-5-4-6-11(25)12(8)16(26)13-9(21)7-10-15(24(2)3)17(27)14(20(23)30)19(29)22(10,32)18(13)28/h4-6,9-10,15,25,27-28,31-32H,7H2,1-3H3,(H2,23,30)/t9-,10-,15-,21+,22-/m0/s1 |
| InChIKey | OFVLGDICTFRJMM-WESIUVDSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetracycline (CHEBI:27902) has role Escherichia coli metabolite (CHEBI:76971) |
| tetracycline (CHEBI:27902) has role antibacterial drug (CHEBI:36047) |
| tetracycline (CHEBI:27902) has role antimicrobial agent (CHEBI:33281) |
| tetracycline (CHEBI:27902) has role antiprotozoal drug (CHEBI:35820) |
| tetracycline (CHEBI:27902) has role protein synthesis inhibitor (CHEBI:48001) |
| tetracycline (CHEBI:27902) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| tetracycline (CHEBI:27902) is a tetracyclines (CHEBI:26895) |
| tetracycline (CHEBI:27902) is tautomer of tetracycline zwitterion (CHEBI:77932) |
| Incoming Relation(s) |
| 11a-hydroxytetracycline (CHEBI:134017) has functional parent tetracycline (CHEBI:27902) |
| tetracycline zwitterion (CHEBI:77932) is tautomer of tetracycline (CHEBI:27902) |
| IUPAC Name |
|---|
| (4S,4aS,5aS,6S,12aS)-4-(dimethylamino)-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide |
| INNs | Source |
|---|---|
| tetracycline | ChemIDplus |
| tetracyclinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (4S,4aS,5aS,12aS)-4-(Dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-2-naphthacenecarboxamide | ChemIDplus |
| Abramycin | ChemIDplus |
| Anhydrotetracycline | DrugBank |
| Deschlorobiomycin | ChemIDplus |
| Liquamycin | ChemIDplus |
| Tetracyclin | ChEBI |
| Brand Name | Source |
|---|---|
| Achromycin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1103368 | Gmelin |
| Reaxys:2230417 | Reaxys |
| CAS:60-54-8 | KEGG COMPOUND |
| CAS:60-54-8 | ChemIDplus |
| Citations |
|---|