EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2Se |
| Net Charge | 0 |
| Average Mass | 196.108 |
| Monoisotopic Mass | 196.99550 |
| SMILES | C[Se]CCC(N)C(=O)O |
| InChI | InChI=1S/C5H11NO2Se/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| InChIKey | RJFAYQIBOAGBLC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selenomethionine (CHEBI:27585) has role plant metabolite (CHEBI:76924) |
| selenomethionine (CHEBI:27585) is a selenoamino acid (CHEBI:26629) |
| selenomethionine (CHEBI:27585) is a selenomethionines (CHEBI:26640) |
| Incoming Relation(s) |
| Se-methylselenomethionine (CHEBI:156246) has functional parent selenomethionine (CHEBI:27585) |
| D-selenomethionine (CHEBI:30022) is a selenomethionine (CHEBI:27585) |
| L-selenomethionine (CHEBI:30021) is a selenomethionine (CHEBI:27585) |
| IUPAC Name |
|---|
| 2-amino-4-(methylseleno)butanoic acid |
| Synonyms | Source |
|---|---|
| Butanoic acid, 2-amino-4-(methylseleno)- | NIST Chemistry WebBook |
| Selenium methionine | ChemIDplus |
| Seleno-DL-methionine | ChemIDplus |
| (±)-selenomethionine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0003966 | HMDB |
| Selenomethionine | Wikipedia |
| SELENOMETHIONINE | MetaCyc |
| Citations |
|---|