EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14NO2Se |
| Net Charge | +1 |
| Average Mass | 211.143 |
| Monoisotopic Mass | 212.01843 |
| SMILES | C[Se+](C)CCC(N)C(=O)O |
| InChI | InChI=1S/C6H13NO2Se/c1-10(2)4-3-5(7)6(8)9/h5H,3-4,7H2,1-2H3/p+1 |
| InChIKey | QALHNGMTIIHGNI-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica juncea (ncbitaxon:3707) | root (BTO:0001188) | PubMed (14763742) | |
| Brassica oleracea (ncbitaxon:3712) | - | PubMed (5118637) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Se-methylselenomethionine (CHEBI:156246) has functional parent selenomethionine (CHEBI:27585) |
| Se-methylselenomethionine (CHEBI:156246) has role plant metabolite (CHEBI:76924) |
| Se-methylselenomethionine (CHEBI:156246) is a selenoamino acid (CHEBI:26629) |
| Se-methylselenomethionine (CHEBI:156246) is a selenomethionines (CHEBI:26640) |
| Se-methylselenomethionine (CHEBI:156246) is a α-amino-acid cation (CHEBI:33719) |
| Incoming Relation(s) |
| Se-methyl-D-selenomethionine (CHEBI:156247) is a Se-methylselenomethionine (CHEBI:156246) |
| Se-methyl-L-selenomethionine (CHEBI:28513) is a Se-methylselenomethionine (CHEBI:156246) |
| IUPAC Name |
|---|
| (3-amino-3-carboxypropyl)(dimethyl)selenonium |
| Synonyms | Source |
|---|---|
| (3-amino-3-carboxypropyl)(dimethyl)selanium | IUPAC |
| (3-amino-3-carboxypropyl)dimethylselanium | ChEBI |
| (3-amino-3-carboxypropyl)dimethylselenonium | ChemIDplus |
| Se-methyl selenomethionine | ChEBI |
| Se-methyl-selenomethionine | ChEBI |
| Citations |
|---|