EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3+,4+,5-,6- |
| InChIKey | CDAISMWEOUEBRE-CDRYSYESSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24352657) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scyllo-inositol (CHEBI:10642) has role antipsychotic agent (CHEBI:35476) |
| scyllo-inositol (CHEBI:10642) has role human metabolite (CHEBI:77746) |
| scyllo-inositol (CHEBI:10642) is a inositol (CHEBI:24848) |
| Incoming Relation(s) |
| scyllo-inositol 1-phosphate(2−) (CHEBI:232087) has functional parent scyllo-inositol (CHEBI:10642) |
| myo-2-inosose (CHEBI:17811) has functional parent scyllo-inositol (CHEBI:10642) |
| 1-amino-1-deoxy-scyllo-inositol (CHEBI:16181) has functional parent scyllo-inositol (CHEBI:10642) |
| 1-guanidino-1-deoxy-scyllo-inositol (CHEBI:17110) has functional parent scyllo-inositol (CHEBI:10642) |
| 1D-1-guanidino-1-deoxy-3-dehydro-scyllo-inositol (CHEBI:17845) has functional parent scyllo-inositol (CHEBI:10642) |
| 1D-3-amino-1-guanidino-1,3-dideoxy-scyllo-inositol (CHEBI:17156) has functional parent scyllo-inositol (CHEBI:10642) |
| 1D-3-amino-1-guanidino-1,3-dideoxy-scyllo-inositol 4-phosphate (CHEBI:27695) has functional parent scyllo-inositol (CHEBI:10642) |
| 1D-3-amino-1-guanidino-1,3-dideoxy-scyllo-inositol 6-phosphate (CHEBI:28399) has functional parent scyllo-inositol (CHEBI:10642) |
| 2-deoxy-scyllo-inosamine (CHEBI:65046) has functional parent scyllo-inositol (CHEBI:10642) |
| 2-deoxy-scyllo-inosose (CHEBI:64796) has functional parent scyllo-inositol (CHEBI:10642) |
| 3-amino-2,3-dideoxy-scyllo-inosose (CHEBI:65027) has functional parent scyllo-inositol (CHEBI:10642) |
| 3-dehydro-scyllo-inosose (CHEBI:137015) has functional parent scyllo-inositol (CHEBI:10642) |
| streptamine (CHEBI:27955) has functional parent scyllo-inositol (CHEBI:10642) |
| streptidine (CHEBI:27405) has functional parent scyllo-inositol (CHEBI:10642) |
| IUPAC Name |
|---|
| scyllo-inositol |
| Synonyms | Source |
|---|---|
| 1,3,5/2,4,6-cyclohexanehexol | IUPAC |
| (1r,2r,3r,4r,5r,6r)-cyclohexane-1,2,3,4,5,6-hexol | IUPAC |
| AZD-103 | ChEMBL |
| Cocositol | NIST Chemistry WebBook |
| ELND-005 | ChEMBL |
| ELND005 | ChEMBL |
| UniProt Name | Source |
|---|---|
| scyllo-inositol | UniProt |
| Citations |
|---|