EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H6O3 |
| Net Charge | 0 |
| Average Mass | 186.166 |
| Monoisotopic Mass | 186.03169 |
| SMILES | O=c1ccc2cc3ccoc3cc2o1 |
| InChI | InChI=1S/C11H6O3/c12-11-2-1-7-5-8-3-4-13-9(8)6-10(7)14-11/h1-6H |
| InChIKey | ZCCUUQDIBDJBTK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| psoralen (CHEBI:27616) has role antineoplastic agent (CHEBI:35610) |
| psoralen (CHEBI:27616) has role plant metabolite (CHEBI:76924) |
| psoralen (CHEBI:27616) is a psoralens (CHEBI:26369) |
| Incoming Relation(s) |
| 5-methoxy-8-(2'-hydroxy-3'-buthoxy-3'-methylbutyloxy)psoralen (CHEBI:66697) has functional parent psoralen (CHEBI:27616) |
| 5-methoxypsoralen (CHEBI:18293) has functional parent psoralen (CHEBI:27616) |
| methoxsalen (CHEBI:18358) has functional parent psoralen (CHEBI:27616) |
| IUPAC Name |
|---|
| 7H-furo[3,2-g]chromen-7-one |
| Synonyms | Source |
|---|---|
| 3-(6-hydroxy-5-benzofuranyl)-2-propenoic acid δ-lactone | NIST Chemistry WebBook |
| 6,7-furanocoumarin | NIST Chemistry WebBook |
| 6-hydroxy-5-benzofuranacrylic acid δ-lactone | NIST Chemistry WebBook |
| 7H-furo[3,2-g][1]benzopyran-7-one | NIST Chemistry WebBook |
| Ficusin | KEGG COMPOUND |
| furo[2',3':7,6]coumarin | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Manaderm | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| psoralen | UniProt |
| Citations |
|---|