EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8O4 |
| Net Charge | 0 |
| Average Mass | 216.192 |
| Monoisotopic Mass | 216.04226 |
| SMILES | COc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C12H8O4/c1-14-12-7-2-3-11(13)16-10(7)6-9-8(12)4-5-15-9/h2-6H,1H3 |
| InChIKey | BGEBZHIAGXMEMV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methoxypsoralen (CHEBI:18293) has functional parent psoralen (CHEBI:27616) |
| 5-methoxypsoralen (CHEBI:18293) has role hepatoprotective agent (CHEBI:62868) |
| 5-methoxypsoralen (CHEBI:18293) has role plant metabolite (CHEBI:76924) |
| 5-methoxypsoralen (CHEBI:18293) is a 5-methoxyfurocoumarin (CHEBI:52061) |
| 5-methoxypsoralen (CHEBI:18293) is a organic heterotricyclic compound (CHEBI:26979) |
| 5-methoxypsoralen (CHEBI:18293) is a psoralens (CHEBI:26369) |
| IUPAC Name |
|---|
| 4-methoxy-7H-furo[3,2-g]chromen-7-one |
| Synonyms | Source |
|---|---|
| 5-Methoxyfuranocoumarin | KEGG COMPOUND |
| Bergapten | KEGG COMPOUND |
| 5-Methoxypsoralen | KEGG COMPOUND |
| O-Methylbergaptol | KEGG COMPOUND |
| Heraclin | ChemIDplus |
| Bergaptene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| bergapten | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C01557 | KEGG COMPOUND |
| 5-METHOXYFURANOCOUMARIN | MetaCyc |
| Bergapten | Wikipedia |
| HMDB0030637 | HMDB |
| D07521 | KEGG DRUG |
| C00000575 | KNApSAcK |
| LSM-20001 | LINCS |
| 3021 | DrugCentral |
| Citations |
|---|