EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H30O13 |
| Net Charge | 0 |
| Average Mass | 586.546 |
| Monoisotopic Mass | 586.16864 |
| SMILES | [H][C@@]12CCOC(=O)C1=CO[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1OC(=O)c1c(O)cc(O)cc1-c1cccc(O)c1)[C@@H]2C=C |
| InChI | InChI=1S/C29H30O13/c1-2-16-17-6-7-38-26(36)19(17)12-39-28(16)42-29-25(24(35)23(34)21(11-30)40-29)41-27(37)22-18(9-15(32)10-20(22)33)13-4-3-5-14(31)8-13/h2-5,8-10,12,16-17,21,23-25,28-35H,1,6-7,11H2/t16-,17+,21-,23-,24+,25-,28+,29+/m1/s1 |
| InChIKey | DBOVHQOUSDWAPQ-WTONXPSSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Swertia chirata (IPNI:60447539-2) | - | DOI (10.1016/S0040-4039(00)72792-4) | |
| Swertia japonica (ncbitaxon:137129) | - | DOI (10.1055/s-2008-1074888) | |
| Swertia mileensis (ncbitaxon:266086) | - | PubMed (8720386) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 5.99.1.2 (DNA topoisomerase) inhibitor A topoisomerase inhibitor that inhibits the bacterial enzymes of the DNA topoisomerases, Type I class (EC 5.99.1.2) that catalyze ATP-independent breakage of one of the two strands of DNA, passage of the unbroken strand through the break, and rejoining of the broken strand. These bacterial enzymes reduce the topological stress in the DNA structure by relaxing negatively, but not positively, supercoiled DNA. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amarogentin (CHEBI:2622) has role EC 5.99.1.2 (DNA topoisomerase) inhibitor (CHEBI:50276) |
| amarogentin (CHEBI:2622) has role metabolite (CHEBI:25212) |
| amarogentin (CHEBI:2622) is a monosaccharide derivative (CHEBI:63367) |
| amarogentin (CHEBI:2622) is a secoiridoid glycoside (CHEBI:50274) |
| IUPAC Name |
|---|
| (4aR)-5t-ethenyl-6c-[O2-(3,5,3'-trihydroxybiphenyl-2-ylcarbonyl)-β-D-glucopyranosyloxy]-4,4ar,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-1-one |
| Synonyms | Source |
|---|---|
| (4aS,5R,6S)-5-ethenyl-1-oxo-4,4a,5,6-tetrahydro-1H,3H-pyrano[3,4-c]pyran-6-yl- 2-O-[(3,3',5-trihydroxybiphenyl-2-yl)carbonyl]-β-D-glucopyranoside | ChEBI |
| Amarogentin | KEGG COMPOUND |
| sweroside-2'-(3'',5'',3'''-trihydroxydiphenyl)-2''-carboxylic acid ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Amarogentin | Wikipedia |
| C00003070 | KNApSAcK |
| C09767 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:74677 | Reaxys |
| CAS:21018-84-8 | KEGG COMPOUND |
| CAS:21018-84-8 | ChemIDplus |
| Citations |
|---|