EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5NO4 |
| Net Charge | 0 |
| Average Mass | 167.120 |
| Monoisotopic Mass | 167.02186 |
| SMILES | O=C(O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5NO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10) |
| InChIKey | SLAMLWHELXOEJZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-nitrobenzoic acid (CHEBI:25620) has functional parent benzoic acid (CHEBI:30746) |
| 2-nitrobenzoic acid (CHEBI:25620) is a nitrobenzoic acid (CHEBI:25553) |
| 2-nitrobenzoic acid (CHEBI:25620) is conjugate acid of 2-nitrobenzoate (CHEBI:25619) |
| Incoming Relation(s) |
| 2-nitrobenzoate (CHEBI:25619) is conjugate base of 2-nitrobenzoic acid (CHEBI:25620) |
| IUPAC Name |
|---|
| 2-nitrobenzoic acid |
| Synonyms | Source |
|---|---|
| o-Carboxynitrobenzene | ChemIDplus |
| o-Nitrobenzoic acid | ChemIDplus |
| 2-Nitrobenzoic acid | KEGG COMPOUND |
| Citations |
|---|