EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4NO4 |
| Net Charge | -1 |
| Average Mass | 166.112 |
| Monoisotopic Mass | 166.01458 |
| SMILES | O=C([O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5NO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)/p-1 |
| InChIKey | SLAMLWHELXOEJZ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-nitrobenzoate (CHEBI:25619) has functional parent benzoate (CHEBI:16150) |
| 2-nitrobenzoate (CHEBI:25619) is a nitrobenzoate (CHEBI:25552) |
| 2-nitrobenzoate (CHEBI:25619) is conjugate base of 2-nitrobenzoic acid (CHEBI:25620) |
| Incoming Relation(s) |
| 2-nitrobenzoic acid (CHEBI:25620) is conjugate acid of 2-nitrobenzoate (CHEBI:25619) |
| IUPAC Name |
|---|
| 2-nitrobenzoate |
| Synonym | Source |
|---|---|
| o-Nitrobenzoate | UM-BBD |
| Manual Xrefs | Databases |
|---|---|
| c0771 | UM-BBD |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1877429 | Beilstein |