EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O2S2 |
| Net Charge | 0 |
| Average Mass | 206.332 |
| Monoisotopic Mass | 206.04352 |
| SMILES | O=C(O)CCCCC1CCSS1 |
| InChI | InChI=1S/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H,9,10) |
| InChIKey | AGBQKNBQESQNJD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lipoic acid (CHEBI:16494) has functional parent octanoic acid (CHEBI:28837) |
| lipoic acid (CHEBI:16494) has role fundamental metabolite (CHEBI:78675) |
| lipoic acid (CHEBI:16494) has role geroprotector (CHEBI:176497) |
| lipoic acid (CHEBI:16494) is a dithiolanes (CHEBI:39192) |
| lipoic acid (CHEBI:16494) is a heterocyclic fatty acid (CHEBI:48847) |
| lipoic acid (CHEBI:16494) is a thia fatty acid (CHEBI:59643) |
| lipoic acid (CHEBI:16494) is conjugate acid of lipoate (CHEBI:30313) |
| Incoming Relation(s) |
| lipoamide (CHEBI:17460) has functional parent lipoic acid (CHEBI:16494) |
| lipoyl-AMP (CHEBI:55451) has functional parent lipoic acid (CHEBI:16494) |
| (R)-lipoic acid (CHEBI:30314) is a lipoic acid (CHEBI:16494) |
| (S)-lipoic acid (CHEBI:43796) is a lipoic acid (CHEBI:16494) |
| lipoate (CHEBI:30313) is conjugate base of lipoic acid (CHEBI:16494) |
| lipoyl group (CHEBI:25064) is substituent group from lipoic acid (CHEBI:16494) |
| IUPAC Name |
|---|
| 5-(1,2-dithiolan-3-yl)pentanoic acid |
| Synonyms | Source |
|---|---|
| 1,2-dithiolane-3-pentanoic acid | ChEBI |
| 1,2-dithiolane-3-valeric acid | ChEBI |
| 5-(1,2-dithiolan-3-yl)valeric acid | ChEBI |
| 5-[3-(1,2-dithiolanyl)]pentanoic acid | ChEBI |
| 5-(dithiolan-3-yl)valeric acid | ChEBI |
| 6,8-thioctic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4732 | DrugCentral |
| C00725 | KEGG COMPOUND |
| D00086 | KEGG DRUG |
| DB00166 | DrugBank |
| ECMDB01451 | ECMDB |
| Lipoic_acid | Wikipedia |
| YMDB00334 | YMDB |
| Citations |
|---|