EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13O2S2 |
| Net Charge | -1 |
| Average Mass | 205.324 |
| Monoisotopic Mass | 205.03625 |
| SMILES | O=C([O-])CCCCC1CCSS1 |
| InChI | InChI=1S/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H,9,10)/p-1 |
| InChIKey | AGBQKNBQESQNJD-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lipoate (CHEBI:30313) has functional parent octanoate (CHEBI:25646) |
| lipoate (CHEBI:30313) has role fundamental metabolite (CHEBI:78675) |
| lipoate (CHEBI:30313) has role human metabolite (CHEBI:77746) |
| lipoate (CHEBI:30313) is a thia fatty acid anion (CHEBI:59848) |
| lipoate (CHEBI:30313) is conjugate base of lipoic acid (CHEBI:16494) |
| Incoming Relation(s) |
| (R)-lipoate (CHEBI:83088) is a lipoate (CHEBI:30313) |
| lipoic acid (CHEBI:16494) is conjugate acid of lipoate (CHEBI:30313) |
| IUPAC Name |
|---|
| 5-(1,2-dithiolan-3-yl)pentanoate |
| Synonyms | Source |
|---|---|
| 6-thiotate | ChEBI |
| 5-(dithiolan-3-yl)valerate | ChEBI |
| 6-thioctate | ChEBI |
| liponate | ChEBI |
| thioctate | ChEBI |
| 6,8-thiotate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2110645 | Gmelin |
| Reaxys:4993294 | Reaxys |