EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O4S |
| Net Charge | 0 |
| Average Mass | 208.239 |
| Monoisotopic Mass | 208.05178 |
| SMILES | NC(CSCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H12N2O4S/c7-3(5(9)10)1-13-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12) |
| InChIKey | DWPCPZJAHOETAG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycobacterium smegmatis (ncbitaxon:1772) | - | PubMed (15716431) | Strain: PM440 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lanthionine (CHEBI:25013) has role bacterial metabolite (CHEBI:76969) |
| lanthionine (CHEBI:25013) is a alanine derivative (CHEBI:22278) |
| lanthionine (CHEBI:25013) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| lanthionine (CHEBI:25013) is a organic sulfide (CHEBI:16385) |
| Incoming Relation(s) |
| meso-lanthionine (CHEBI:25205) is a lanthionine (CHEBI:25013) |
| L-lanthionine (CHEBI:21347) is a lanthionine (CHEBI:25013) |
| Manual Xrefs | Databases |
|---|---|
| Lanthionine | Wikipedia |
| Citations |
|---|