EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O4S |
| Net Charge | 0 |
| Average Mass | 208.239 |
| Monoisotopic Mass | 208.05178 |
| SMILES | N[C@@H](CSC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H12N2O4S/c7-3(5(9)10)1-13-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1 |
| InChIKey | DWPCPZJAHOETAG-IMJSIDKUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-lanthionine (CHEBI:21347) is a L-alanine derivative (CHEBI:83943) |
| L-lanthionine (CHEBI:21347) is a lanthionine (CHEBI:25013) |
| L-lanthionine (CHEBI:21347) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-lanthionine (CHEBI:21347) is tautomer of L-lanthionine dizwitterion (CHEBI:178193) |
| Incoming Relation(s) |
| L-lanthionine dizwitterion (CHEBI:178193) is tautomer of L-lanthionine (CHEBI:21347) |
| IUPAC Names |
|---|
| (2R,2'R)-3,3'-sulfanediylbis(2-aminopropanoic acid) |
| L-lanthionine |
| Synonyms | Source |
|---|---|
| 3,3'-thiobis-L-alanine | ChEBI |
| 3,3'-thiodi-L-alanine | MetaCyc |
| (R)-S-(2-amino-2-carboxyethyl)-L-cysteine | ChEBI |
| (R,R)-2,6-diamino-4-thiaheptanedioic acid | ChEBI |
| (R,R)-3,3'-thiobis-(2-aminopropanoic acid) | ChEBI |
| (R,R)-bis(2-amino-2-carboxyethyl)sulfide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 85F | PDBeChem |
| 88959 | ChemSpider |
| CPD-3736 | MetaCyc |
| HMDB0240656 | HMDB |
| Lanthionine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:922-55-4 | ChemIDplus |
| Citations |
|---|