EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:18157 - aerobactin
| Formula | C22H36N4O13 |
| Net Charge | 0 |
| Average Mass | 564.545 |
| Monoisotopic Mass | 564.22789 |
| SMILES | CC(=O)N(O)CCCC[C@H](NC(=O)CC(O)(CC(=O)N[C@@H](CCCCN(O)C(C)=O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H36N4O13/c1-13(27)25(38)9-5-3-7-15(19(31)32)23-17(29)11-22(37,21(35)36)12-18(30)24-16(20(33)34)8-4-6-10-26(39)14(2)28/h15-16,37-39H,3-12H2,1-2H3,(H,23,29)(H,24,30)(H,31,32)(H,33,34)(H,35,36)/t15-,16-/m0/s1 |
| InChIKey | KDHHWXGBNUCREU-HOTGVXAUSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. virulence factor Any toxin secreted by bacteria, viruses, fungi or protozoa enabling them to achieve colonisation of a niche in the host, inhibit or evade the host's immune response, enter and exit cells, or obtain nutrition from the host. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aerobactin (CHEBI:18157) has role Escherichia coli metabolite (CHEBI:76971) |
| aerobactin (CHEBI:18157) has role siderophore (CHEBI:26672) |
| aerobactin (CHEBI:18157) has role virulence factor (CHEBI:72316) |
| aerobactin (CHEBI:18157) is a L-lysine derivative (CHEBI:25095) |
| aerobactin (CHEBI:18157) is conjugate acid of aerobactinate(3−) (CHEBI:58396) |
| Incoming Relation(s) |
| aerobactinate(3−) (CHEBI:58396) is conjugate base of aerobactin (CHEBI:18157) |
| IUPAC Name |
|---|
| N2,N2'-(3-carboxy-3-hydroxypentanedioyl)bis(N6-acetyl-N6-hydroxy-L-lysine) |
| Synonyms | Source |
|---|---|
| (8S,16S)-3,12,21-trihydroxy-2,10,14,22-tetraoxo-3,9,15,21-tetraazatricosane-8,12,16-tricarboxylic acid | ChEBI |
| Aerobactin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| Aerobactin | Wikipedia |
| AEROBACTIN | MetaCyc |
| C05554 | KEGG COMPOUND |
| FDB023292 | FooDB |
| HMDB0004051 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:26198-65-2 | KEGG COMPOUND |
| CAS:26198-65-2 | ChemIDplus |
| Citations |
|---|