EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36N4O13 |
| Net Charge | 0 |
| Average Mass | 564.545 |
| Monoisotopic Mass | 564.22789 |
| SMILES | CC(=O)N(O)CCCC[C@H](NC(=O)CC(O)(CC(=O)N[C@@H](CCCCN(O)C(C)=O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H36N4O13/c1-13(27)25(38)9-5-3-7-15(19(31)32)23-17(29)11-22(37,21(35)36)12-18(30)24-16(20(33)34)8-4-6-10-26(39)14(2)28/h15-16,37-39H,3-12H2,1-2H3,(H,23,29)(H,24,30)(H,31,32)(H,33,34)(H,35,36)/t15-,16-/m0/s1 |
| InChIKey | KDHHWXGBNUCREU-HOTGVXAUSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Roles: | virulence factor Any toxin secreted by bacteria, viruses, fungi or protozoa enabling them to achieve colonisation of a niche in the host, inhibit or evade the host's immune response, enter and exit cells, or obtain nutrition from the host. siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aerobactin (CHEBI:18157) has role Escherichia coli metabolite (CHEBI:76971) |
| aerobactin (CHEBI:18157) has role siderophore (CHEBI:26672) |
| aerobactin (CHEBI:18157) has role virulence factor (CHEBI:72316) |
| aerobactin (CHEBI:18157) is a L-lysine derivative (CHEBI:25095) |
| aerobactin (CHEBI:18157) is conjugate acid of aerobactinate(3−) (CHEBI:58396) |
| Incoming Relation(s) |
| aerobactinate(3−) (CHEBI:58396) is conjugate base of aerobactin (CHEBI:18157) |
| IUPAC Name |
|---|
| N2,N2'-(3-carboxy-3-hydroxypentanedioyl)bis(N6-acetyl-N6-hydroxy-L-lysine) |
| Synonyms | Source |
|---|---|
| (8S,16S)-3,12,21-trihydroxy-2,10,14,22-tetraoxo-3,9,15,21-tetraazatricosane-8,12,16-tricarboxylic acid | ChEBI |
| Aerobactin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| Aerobactin | Wikipedia |
| AEROBACTIN | MetaCyc |
| C05554 | KEGG COMPOUND |
| FDB023292 | FooDB |
| HMDB0004051 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:26198-65-2 | KEGG COMPOUND |
| CAS:26198-65-2 | ChemIDplus |
| Citations |
|---|