EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | C=C(C)C1CCC(C)=CC1O |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h6,9-11H,1,4-5H2,2-3H3 |
| InChIKey | OLAKPNFIICOONC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isopiperitenol (CHEBI:24911) has role volatile oil component (CHEBI:27311) |
| isopiperitenol (CHEBI:24911) is a p-menthane monoterpenoid (CHEBI:25186) |
| Incoming Relation(s) |
| (+)-trans-isopiperitenol (CHEBI:169979) is a isopiperitenol (CHEBI:24911) |
| (−)-trans-isopiperitenol (CHEBI:15406) is a isopiperitenol (CHEBI:24911) |
| IUPAC Names |
|---|
| 3-methyl-6-(prop-1-en-2-yl)cyclohex-2-en-1-ol |
| p-mentha-1,8-dien-3-ol |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2207765 | Beilstein |