EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1O |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h6,9-11H,1,4-5H2,2-3H3/t9-,10+/m0/s1 |
| InChIKey | OLAKPNFIICOONC-VHSXEESVSA-N |
| Roles Classification |
|---|
| Biological Role: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-trans-isopiperitenol (CHEBI:169979) is a isopiperitenol (CHEBI:24911) |
| (+)-trans-isopiperitenol (CHEBI:169979) is enantiomer of (−)-trans-isopiperitenol (CHEBI:15406) |
| Incoming Relation(s) |
| (−)-trans-isopiperitenol (CHEBI:15406) is enantiomer of (+)-trans-isopiperitenol (CHEBI:169979) |
| IUPAC Names |
|---|
| (1R,6S)-3-methyl-6-(prop-1-en-2-yl)cyclohex-2-en-1-ol |
| (1R,6S)-p-mentha-1,8-dien-3-ol |
| UniProt Name | Source |
|---|---|
| (1R,6S)-isopiperitenol | UniProt |
| Citations |
|---|