EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO4 |
| Net Charge | 0 |
| Average Mass | 133.103 |
| Monoisotopic Mass | 133.03751 |
| SMILES | O=C(O)CNCC(=O)O |
| InChI | InChI=1S/C4H7NO4/c6-3(7)1-5-2-4(8)9/h5H,1-2H2,(H,6,7)(H,8,9) |
| InChIKey | NBZBKCUXIYYUSX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iminodiacetic acid (CHEBI:24786) has role chelator (CHEBI:38161) |
| iminodiacetic acid (CHEBI:24786) is a amino dicarboxylic acid (CHEBI:36164) |
| iminodiacetic acid (CHEBI:24786) is a glycine derivative (CHEBI:24373) |
| iminodiacetic acid (CHEBI:24786) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| iminodiacetic acid (CHEBI:24786) is conjugate acid of iminodiacetate (CHEBI:24785) |
| Incoming Relation(s) |
| N-(2-hydroxyethyl)iminodiacetic acid (CHEBI:143268) has functional parent iminodiacetic acid (CHEBI:24786) |
| N-(carboxymethyl)-L-alanine (CHEBI:149655) has functional parent iminodiacetic acid (CHEBI:24786) |
| iminodiacetate (CHEBI:24785) is conjugate base of iminodiacetic acid (CHEBI:24786) |
| IUPAC Name |
|---|
| 2,2'-iminodiacetic acid |
| Synonyms | Source |
|---|---|
| 2,2'-azanediyldiacetic acid | IUPAC |
| 2-[(carboxymethyl)amino]acetic acid | IUPAC |
| aminodiacetic acid | ChemIDplus |
| bis(carboxymethyl)amine | NIST Chemistry WebBook |
| diglycine | ChemIDplus |
| diglycocoll | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| c0558 | UM-BBD |
| CPD-10189 | MetaCyc |
| FDB028424 | FooDB |
| HMDB0011753 | HMDB |
| Iminodiacetic_acid | Wikipedia |
| Citations |
|---|