EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO4 |
| Net Charge | 0 |
| Average Mass | 147.130 |
| Monoisotopic Mass | 147.05316 |
| SMILES | C[C@H](NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c1-3(5(9)10)6-2-4(7)8/h3,6H,2H2,1H3,(H,7,8)(H,9,10)/t3-/m0/s1 |
| InChIKey | XYUPSBLFPTWJLC-VKHMYHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crassostrea gigas (ncbitaxon:29159) | - | PubMed (6156653) | |
| Crassostrea virginica (ncbitaxon:6565) | - | DOI (/10.1139/z83-353) | |
| Strombus gigas (ncbitaxon:291982) | - | Article (Book: Dictionary of Marine Natural Products with CD-ROM, C-106) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(carboxymethyl)-L-alanine (CHEBI:149655) has functional parent iminodiacetic acid (CHEBI:24786) |
| N-(carboxymethyl)-L-alanine (CHEBI:149655) has role animal metabolite (CHEBI:75767) |
| N-(carboxymethyl)-L-alanine (CHEBI:149655) has role marine metabolite (CHEBI:76507) |
| N-(carboxymethyl)-L-alanine (CHEBI:149655) is a L-alanine derivative (CHEBI:83943) |
| N-(carboxymethyl)-L-alanine (CHEBI:149655) is a amino dicarboxylic acid (CHEBI:36164) |
| IUPAC Name |
|---|
| N-(carboxymethyl)-L-alanine |
| Synonyms | Source |
|---|---|
| (2S)-2-[(carboxymethyl)amino]propanoic acid | IUPAC |
| (2S)-2-methyliminodiacetic acid | ChEBI |
| (S)-2-[(carboxymethyl)amino]propanoic acid | ChEBI |
| (S)-2-methyliminodiacetic acid | ChEBI |
| (S)-strombine | ChEBI |
| ChEBI | |
| Registry Numbers | Sources |
|---|---|
| CAS:56857-47-7 | ChEBI |
| Citations |
|---|