EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2469 - adefovir
| Formula | C8H12N5O4P |
| Net Charge | 0 |
| Average Mass | 273.189 |
| Monoisotopic Mass | 273.06269 |
| SMILES | Nc1ncnc2c1ncn2CCOCP(=O)(O)O |
| InChI | InChI=1S/C8H12N5O4P/c9-7-6-8(11-3-10-7)13(4-12-6)1-2-17-5-18(14,15)16/h3-4H,1-2,5H2,(H2,9,10,11)(H2,14,15,16) |
| InChIKey | SUPKOOSCJHTBAH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adefovir (CHEBI:2469) has functional parent adenine (CHEBI:16708) |
| adefovir (CHEBI:2469) has role anti-HBV agent (CHEBI:64951) |
| adefovir (CHEBI:2469) has role anti-HIV agent (CHEBI:64946) |
| adefovir (CHEBI:2469) has role antiviral drug (CHEBI:36044) |
| adefovir (CHEBI:2469) has role DNA synthesis inhibitor (CHEBI:59517) |
| adefovir (CHEBI:2469) has role drug metabolite (CHEBI:49103) |
| adefovir (CHEBI:2469) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| adefovir (CHEBI:2469) has role nephrotoxic agent (CHEBI:50909) |
| adefovir (CHEBI:2469) is a 6-aminopurines (CHEBI:20706) |
| adefovir (CHEBI:2469) is a ether (CHEBI:25698) |
| adefovir (CHEBI:2469) is a phosphonic acids (CHEBI:26069) |
| adefovir (CHEBI:2469) is conjugate acid of adefovir(1−) (CHEBI:134512) |
| Incoming Relation(s) |
| adefovir pivoxil (CHEBI:31175) has functional parent adefovir (CHEBI:2469) |
| adefovir(1−) (CHEBI:134512) is conjugate base of adefovir (CHEBI:2469) |
| IUPAC Name |
|---|
| {[2-(6-amino-9H-purin-9-yl)ethoxy]methyl}phosphonic acid |
| Synonyms | Source |
|---|---|
| 9-(2-(Phosphonomethoxy)ethyl)adenine | ChemIDplus |
| 9-(2-Phosphonylmethoxyethyl)adenine | KEGG COMPOUND |
| 9-(2-Phosphonylmethoxyethyl)adenine | ChemIDplus |
| Adefovir | KEGG COMPOUND |
| DRG-0156 | ChemIDplus |
| GS 0393 | ChemIDplus |
| Citations |
|---|