EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N5O4P |
| Net Charge | 0 |
| Average Mass | 273.189 |
| Monoisotopic Mass | 273.06269 |
| SMILES | Nc1ncnc2c1ncn2CCOCP(=O)(O)O |
| InChI | InChI=1S/C8H12N5O4P/c9-7-6-8(11-3-10-7)13(4-12-6)1-2-17-5-18(14,15)16/h3-4H,1-2,5H2,(H2,9,10,11)(H2,14,15,16) |
| InChIKey | SUPKOOSCJHTBAH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| adefovir (CHEBI:2469) has functional parent adenine (CHEBI:16708) |
| adefovir (CHEBI:2469) has role antiviral drug (CHEBI:36044) |
| adefovir (CHEBI:2469) has role DNA synthesis inhibitor (CHEBI:59517) |
| adefovir (CHEBI:2469) has role drug metabolite (CHEBI:49103) |
| adefovir (CHEBI:2469) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| adefovir (CHEBI:2469) has role nephrotoxic agent (CHEBI:50909) |
| adefovir (CHEBI:2469) is a 6-aminopurines (CHEBI:20706) |
| adefovir (CHEBI:2469) is a ether (CHEBI:25698) |
| adefovir (CHEBI:2469) is a phosphonic acids (CHEBI:26069) |
| adefovir (CHEBI:2469) is conjugate acid of adefovir(1−) (CHEBI:134512) |
| Incoming Relation(s) |
| adefovir pivoxil (CHEBI:31175) has functional parent adefovir (CHEBI:2469) |
| adefovir(1−) (CHEBI:134512) is conjugate base of adefovir (CHEBI:2469) |
| IUPAC Name |
|---|
| {[2-(6-amino-9H-purin-9-yl)ethoxy]methyl}phosphonic acid |
| Synonyms | Source |
|---|---|
| 9-(2-(Phosphonomethoxy)ethyl)adenine | ChemIDplus |
| 9-(2-Phosphonylmethoxyethyl)adenine | KEGG COMPOUND |
| 9-(2-Phosphonylmethoxyethyl)adenine | ChemIDplus |
| Adefovir | KEGG COMPOUND |
| DRG-0156 | ChemIDplus |
| GS 0393 | ChemIDplus |
| Citations |
|---|