EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O2 |
| Net Charge | 0 |
| Average Mass | 230.307 |
| Monoisotopic Mass | 230.13068 |
| SMILES | [H][C@@]12CCC(=C)[C@]1([H])[C@H]1OC(=O)C(=C)[C@@H]1CCC2=C |
| InChI | InChI=1S/C15H18O2/c1-8-4-7-12-10(3)15(16)17-14(12)13-9(2)5-6-11(8)13/h11-14H,1-7H2/t11-,12-,13-,14-/m0/s1 |
| InChIKey | NETSQGRTUNRXEO-XUXIUFHCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laurus nobilis (ncbitaxon:85223) | leaf (BTO:0000713) | PubMed (12419922) | |
| Saussurea lappa (ncbitaxon:324593) | root (BTO:0001188) | PubMed (8541643) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehydrocostus lactone (CHEBI:244418) has role antimycobacterial drug (CHEBI:64912) |
| dehydrocostus lactone (CHEBI:244418) has role antineoplastic agent (CHEBI:35610) |
| dehydrocostus lactone (CHEBI:244418) has role apoptosis inducer (CHEBI:68495) |
| dehydrocostus lactone (CHEBI:244418) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| dehydrocostus lactone (CHEBI:244418) has role metabolite (CHEBI:25212) |
| dehydrocostus lactone (CHEBI:244418) has role trypanocidal drug (CHEBI:36335) |
| dehydrocostus lactone (CHEBI:244418) is a guaiane sesquiterpenoid (CHEBI:36744) |
| dehydrocostus lactone (CHEBI:244418) is a organic heterotricyclic compound (CHEBI:26979) |
| dehydrocostus lactone (CHEBI:244418) is a sesquiterpene lactone (CHEBI:37667) |
| dehydrocostus lactone (CHEBI:244418) is a γ-lactone (CHEBI:37581) |
| IUPAC Names |
|---|
| (3aR,6aS,9aS,9bR)-3,6,9-tris(methylene)octahydroazuleno[4,5-b]furan-2,8(3H,4H)-dione |
| (3aR,6aS,9aS,9bR)-3,6,9-tris(methylidene)octahydroazuleno[4,5-b]furan-2,8(3H,4H)-dione |
| Synonyms | Source |
|---|---|
| (3aS,6aR,9aR,9bS)-decahydro-3,6,9-tris(methylene)azuleno[4,5-b]furan-2(3H)-one | ChEBI |
| (−)-dehydrocostus lactone | ChEBI |
| (−)-dehydrocostuslactone | ChEBI |
| dehydrocostuslactone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00003245 | KNApSAcK |
| C09387 | KEGG COMPOUND |
| CN102058579 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4733740 | Reaxys |
| CAS:477-43-0 | ChemIDplus |
| CAS:477-43-0 | KEGG COMPOUND |
| Citations |
|---|