EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O2 |
| Net Charge | 0 |
| Average Mass | 230.307 |
| Monoisotopic Mass | 230.13068 |
| SMILES | [H][C@@]12CCC(=C)[C@]1([H])[C@H]1OC(=O)C(=C)[C@@H]1CCC2=C |
| InChI | InChI=1S/C15H18O2/c1-8-4-7-12-10(3)15(16)17-14(12)13-9(2)5-6-11(8)13/h11-14H,1-7H2/t11-,12-,13-,14-/m0/s1 |
| InChIKey | NETSQGRTUNRXEO-XUXIUFHCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laurus nobilis (ncbitaxon:85223) | leaf (BTO:0000713) | PubMed (12419922) | |
| Saussurea lappa (ncbitaxon:324593) | root (BTO:0001188) | PubMed (8541643) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehydrocostus lactone (CHEBI:244418) has role antimycobacterial drug (CHEBI:64912) |
| dehydrocostus lactone (CHEBI:244418) has role antineoplastic agent (CHEBI:35610) |
| dehydrocostus lactone (CHEBI:244418) has role apoptosis inducer (CHEBI:68495) |
| dehydrocostus lactone (CHEBI:244418) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| dehydrocostus lactone (CHEBI:244418) has role metabolite (CHEBI:25212) |
| dehydrocostus lactone (CHEBI:244418) has role trypanocidal drug (CHEBI:36335) |
| dehydrocostus lactone (CHEBI:244418) is a guaiane sesquiterpenoid (CHEBI:36744) |
| dehydrocostus lactone (CHEBI:244418) is a organic heterotricyclic compound (CHEBI:26979) |
| dehydrocostus lactone (CHEBI:244418) is a sesquiterpene lactone (CHEBI:37667) |
| dehydrocostus lactone (CHEBI:244418) is a γ-lactone (CHEBI:37581) |
| IUPAC Names |
|---|
| (3aR,6aS,9aS,9bR)-3,6,9-tris(methylidene)octahydroazuleno[4,5-b]furan-2,8(3H,4H)-dione |
| (3aR,6aS,9aS,9bR)-3,6,9-tris(methylene)octahydroazuleno[4,5-b]furan-2,8(3H,4H)-dione |
| Synonyms | Source |
|---|---|
| (3aS,6aR,9aR,9bS)-decahydro-3,6,9-tris(methylene)azuleno[4,5-b]furan-2(3H)-one | ChEBI |
| (−)-dehydrocostuslactone | ChEBI |
| dehydrocostuslactone | ChEBI |
| (−)-dehydrocostus lactone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CN102058579 | Patent |
| C09387 | KEGG COMPOUND |
| C00003245 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4733740 | Reaxys |
| CAS:477-43-0 | KEGG COMPOUND |
| CAS:477-43-0 | ChemIDplus |
| Citations |
|---|