EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17NO4 |
| Net Charge | 0 |
| Average Mass | 311.337 |
| Monoisotopic Mass | 311.11576 |
| SMILES | [H][C@]12Cc3cc(O)c(OC)cc3-c3c4c(cc(c31)CCN2)OCO4 |
| InChI | InChI=1S/C18H17NO4/c1-21-14-7-11-10(5-13(14)20)4-12-16-9(2-3-19-12)6-15-18(17(11)16)23-8-22-15/h5-7,12,19-20H,2-4,8H2,1H3/t12-/m0/s1 |
| InChIKey | VYJUHRAQPIBWNV-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cinnamomum insularimontanum (ncbitaxon:119264) | root (BTO:0001188) | PubMed (16168547) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. topoisomerase inhibitor An EC 5.99.1.* (miscellaneous isomerase) inhibitor that interferes with the action of any of the topoisomerases (enzymes that regulate the overwinding or underwinding of DNA). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| actinodaphnine (CHEBI:2444) has role antibacterial agent (CHEBI:33282) |
| actinodaphnine (CHEBI:2444) has role antifungal agent (CHEBI:35718) |
| actinodaphnine (CHEBI:2444) has role antineoplastic agent (CHEBI:35610) |
| actinodaphnine (CHEBI:2444) has role apoptosis inducer (CHEBI:68495) |
| actinodaphnine (CHEBI:2444) has role plant metabolite (CHEBI:76924) |
| actinodaphnine (CHEBI:2444) has role platelet aggregation inhibitor (CHEBI:50427) |
| actinodaphnine (CHEBI:2444) has role topoisomerase inhibitor (CHEBI:70727) |
| actinodaphnine (CHEBI:2444) is a aporphine alkaloid (CHEBI:134209) |
| actinodaphnine (CHEBI:2444) is a aromatic ether (CHEBI:35618) |
| actinodaphnine (CHEBI:2444) is a organic heteropentacyclic compound (CHEBI:38164) |
| actinodaphnine (CHEBI:2444) is a phenols (CHEBI:33853) |
| actinodaphnine (CHEBI:2444) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| (S)-11-methoxy-6,7,7a,8-tetrahydro-5H-benzo[g][1,3]dioxolo[4',5':4,5]benzo[1,2,3-de]quinolin-10-ol |
| Synonyms | Source |
|---|---|
| 1,2-Methylenedioxy-9-hydroxy-10-methoxynoraporphine | KNApSAcK |
| Actinodaphine | KEGG COMPOUND |
| (+)-Actinodaphnine | ChemIDplus |
| Actinodaphnine | KEGG COMPOUND |
| Citations |
|---|