EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O7 |
| Net Charge | 0 |
| Average Mass | 378.421 |
| Monoisotopic Mass | 378.16785 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@]1(CC3=C)[C@@H](C(=O)O)[C@@]1([H])[C@@]2(C(=O)O)CCC[C@@]1(C)C(=O)O |
| InChI | InChI=1S/C20H26O7/c1-10-8-18-9-19(10,27)7-4-11(18)20(16(25)26)6-3-5-17(2,15(23)24)13(20)12(18)14(21)22/h11-13,27H,1,3-9H2,2H3,(H,21,22)(H,23,24)(H,25,26)/t11-,12-,13-,17-,18+,19+,20-/m1/s1 |
| InChIKey | AUKMHZZVLPQAOX-CDNFTCFOSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant hormone A plant growth regulator that modulates the formation of stems, leaves and flowers, as well as the development and ripening of fruit. The term includes endogenous and non-endogenous compounds (e.g. active compounds produced by bacteria on the leaf surface) as well as semi-synthetic and fully synthetic compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibberellin A17 (CHEBI:24236) is a C20-gibberellin (CHEBI:20859) |
| gibberellin A17 (CHEBI:24236) is a tricarboxylic acid (CHEBI:27093) |
| gibberellin A17 (CHEBI:24236) is conjugate acid of gibberellin A17(3−) (CHEBI:143958) |
| Incoming Relation(s) |
| gibberellin A17(3−) (CHEBI:143958) is conjugate base of gibberellin A17 (CHEBI:24236) |
| IUPAC Names |
|---|
| (1S,2S,3R,4R,8R,9R,12S)-12-hydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4,8-tricarboxylic acid |
| 7α-hydroxy-1β-methyl-8-methylidene-4aα,4bβ-gibbane-1α,4a,10β-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| GA17 | ChEBI |
| gibberellin 17 | ChEBI |