EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | C=C(C)C1CCC(C)C(=O)C1 |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-9H,1,4-6H2,2-3H3 |
| InChIKey | AZOCECCLWFDTAP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrocarvone (CHEBI:23733) has role plant metabolite (CHEBI:76924) |
| dihydrocarvone (CHEBI:23733) is a dihydrocarvones (CHEBI:61672) |
| Incoming Relation(s) |
| (+)-dihydrocarvone (CHEBI:154) is a dihydrocarvone (CHEBI:23733) |
| (+)-isodihydrocarvone (CHEBI:166) is a dihydrocarvone (CHEBI:23733) |
| (−)-dihydrocarvone (CHEBI:168) is a dihydrocarvone (CHEBI:23733) |
| (−)-isodihydrocarvone (CHEBI:155) is a dihydrocarvone (CHEBI:23733) |
| IUPAC Names |
|---|
| 2-methyl-5-(prop-1-en-2-yl)cyclohexanone |
| p-menth-8-en-2-one |
| Synonyms | Source |
|---|---|
| 2-Methyl-5-(1-methylethenyl)cyclohexanone | KEGG COMPOUND |
| 2-Methyl-5-(1-methylethenyl)cyclohexanone | ChEBI |
| 2-methyl-5-isopropenylcyclohexanone | ChEBI |
| 5-isopropenyl-2-methylcyclohexanone | ChEBI |
| 8-p-Menthen-2-one | UM-BBD |
| Menth-8-en-2-one | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| dihydrocarvone | UniProt |
| Citations |
|---|