EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)C(=O)C1 |
| InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-9H,1,4-6H2,2-3H3/t8-,9-/m1/s1 |
| InChIKey | AZOCECCLWFDTAP-RKDXNWHRSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| IUPAC Names |
|---|
| (2R,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexanone |
| (1R,4R)-p-menth-8-en-2-one |
| Synonyms | Source |
|---|---|
| (2R,5R)-2-methyl-5-isopropenylcyclohexanone | ChEBI |
| (2R,5R)-5-isopropenyl-2-methylcyclohexanone | ChEBI |
| (2R-trans)-2-Methyl-5-(1-methylvinyl)cyclohexan-1-one | ChemIDplus |
| d-Dihydrocarvone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (1R,4R)-dihydrocarvone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C11398 | KEGG COMPOUND |
| LMPR0102090033 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2044615 | Reaxys |
| CAS:5524-05-0 | ChemIDplus |
| Citations |
|---|