EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H38F3N3O8 |
| Net Charge | 0 |
| Average Mass | 709.718 |
| Monoisotopic Mass | 709.26110 |
| SMILES | [H][C@@]12Cc3cc(C)c(OC)c(O)c3[C@@]([H])(N1C)[C@]1([H])Cc3c(OC(C)=O)c(C)c4c(c3[C@H](CNC(=O)/C=C/c3cccc(C(F)(F)F)c3)N1[C@H]2O)OCO4 |
| InChI | InChI=1S/C37H38F3N3O8/c1-17-11-21-13-25-36(47)43-24(30(42(25)4)28(21)31(46)32(17)48-5)14-23-29(35-34(49-16-50-35)18(2)33(23)51-19(3)44)26(43)15-41-27(45)10-9-20-7-6-8-22(12-20)37(38,39)40/h6-12,24-26,30,36,46-47H,13-16H2,1-5H3,(H,41,45)/b10-9+/t24-,25-,26-,30-,36-/m0/s1 |
| InChIKey | VPAHZSUNBOYNQY-DLVGLDQCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PM00104 (CHEBI:235523) has role alkylating agent (CHEBI:22333) |
| PM00104 (CHEBI:235523) has role antineoplastic agent (CHEBI:35610) |
| PM00104 (CHEBI:235523) has role apoptosis inducer (CHEBI:68495) |
| PM00104 (CHEBI:235523) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| PM00104 (CHEBI:235523) is a acetate ester (CHEBI:47622) |
| PM00104 (CHEBI:235523) is a bridged compound (CHEBI:35990) |
| PM00104 (CHEBI:235523) is a enamide (CHEBI:51751) |
| PM00104 (CHEBI:235523) is a ether (CHEBI:25698) |
| PM00104 (CHEBI:235523) is a organic heterohexacyclic compound (CHEBI:51914) |
| PM00104 (CHEBI:235523) is a organic hydroxy compound (CHEBI:33822) |
| PM00104 (CHEBI:235523) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (6aS,7R,13S,14S,16R)-8,14-dihydroxy-9-methoxy-4,10,17-trimethyl-16-[({(2E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl}amino)methyl]-6,7,12,13,14,16-hexahydro-6aH-7,13-epimino[1,3]dioxolo[7,8]isoquinolino[3,2-b][3]benzazocin-5-yl acetate |
| Synonyms | Source |
|---|---|
| PM 00104 | ChEBI |
| PM-00104 | ChEBI |
| PM 10450 | ChEBI |
| PM-10450 | ChEBI |
| PM10450 | ChEBI |
| Brand Name | Source |
|---|---|
| Zalypsis | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| DB12454 | DrugBank |
| EP2307003 | Patent |
| HMDB0259984 | HMDB |
| WO2008135792 | Patent |
| WO2011048210 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:308359-57-1 | DrugBank |
| Citations |
|---|