EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11N3O |
| Net Charge | 0 |
| Average Mass | 141.174 |
| Monoisotopic Mass | 141.09021 |
| SMILES | N[C@@H](CO)Cc1cncn1 |
| InChI | InChI=1S/C6H11N3O/c7-5(3-10)1-6-2-8-4-9-6/h2,4-5,10H,1,3,7H2,(H,8,9)/t5-/m1/s1 |
| InChIKey | ZQISRDCJNBUVMM-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-histidinol (CHEBI:235517) is a histidinol (CHEBI:43321) |
| D-histidinol (CHEBI:235517) is enantiomer of L-histidinol (CHEBI:16255) |
| Incoming Relation(s) |
| L-histidinol (CHEBI:16255) is enantiomer of D-histidinol (CHEBI:235517) |
| IUPAC Name |
|---|
| (2R)-2-amino-3-(1H-imidazol-4-yl)propan-1-ol |
| Synonyms | Source |
|---|---|
| (R)-2-amino-3-(1H-imidazol-4-yl)propan-1-ol | ChEBI |
| (2R)-2-amino-3-(1H-imidazol-4-yl)-1-propanol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:70142-15-3 | ChEBI |