EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22ClNO4 |
| Net Charge | 0 |
| Average Mass | 363.841 |
| Monoisotopic Mass | 363.12374 |
| SMILES | Cc1cc(Cl)cc(C)c1C1=C(O)C2(CCC3(CC2)OCCO3)NC1=O |
| InChI | InChI=1S/C19H22ClNO4/c1-11-9-13(20)10-12(2)14(11)15-16(22)18(21-17(15)23)3-5-19(6-4-18)24-7-8-25-19/h9-10,22H,3-8H2,1-2H3,(H,21,23) |
| InChIKey | CMURKFSRGAWINZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor An EC 6.4.1.* (C‒C bond-forming ligase) inhibitor that interferes with the action of acetyl-CoA carboxylase (EC 6.4.1.2). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spidoxamat (CHEBI:234416) has role agrochemical (CHEBI:33286) |
| spidoxamat (CHEBI:234416) has role EC 6.4.1.2 (acetyl-CoA carboxylase) inhibitor (CHEBI:70722) |
| spidoxamat (CHEBI:234416) has role insecticide (CHEBI:24852) |
| spidoxamat (CHEBI:234416) is a enamide (CHEBI:51751) |
| spidoxamat (CHEBI:234416) is a enol (CHEBI:33823) |
| spidoxamat (CHEBI:234416) is a methylbenzene (CHEBI:38975) |
| spidoxamat (CHEBI:234416) is a monochlorobenzenes (CHEBI:83403) |
| spidoxamat (CHEBI:234416) is a oxaspiro compound (CHEBI:37948) |
| IUPAC Name |
|---|
| 11-(4-chloro-2,6-dimethylphenyl)-12-hydroxy-1,4-dioxa-9-azadispiro[4.2.48.25]tetradec-11-en-10-one |
| Synonyms | Source |
|---|---|
| 11-(4-chloro-2,6-xylyl)-12-hydroxy-1,4-dioxa-9-azadispiro[4.2.4.2]tetradec-11-en-10-one | Alan Wood's Pesticides |
| 11-(4-chloro-2,6-dimethylphenyl)-12-hydroxy-1,4-dioxa-9-azadispiro[4.2.4.2]tetradec-11-en-10-one | Alan Wood's Pesticides |
| BCS-AA10147 | PPDB |
| Brand Name | Source |
|---|---|
| Plenexos | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3356 | PPDB |
| spidoxamat | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21066244 | Reaxys |
| CAS:907187-07-9 | Alan Wood's Pesticides |
| Citations |
|---|