EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17N3 |
| Net Charge | 0 |
| Average Mass | 191.278 |
| Monoisotopic Mass | 191.14225 |
| SMILES | [H][C@@]1(c2cccnc2)[C@@H](CN)CCN1C |
| InChI | InChI=1S/C11H17N3/c1-14-6-4-9(7-12)11(14)10-3-2-5-13-8-10/h2-3,5,8-9,11H,4,6-7,12H2,1H3/t9-,11+/m1/s1 |
| InChIKey | IUMCSWXAFXSTAI-KOLCDFICSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-3'-AmNic (CHEBI:234410) is a 3'-AmNic (CHEBI:234407) |
| Incoming Relation(s) |
| 4-({[(2S,3R)-1-methyl-2-(pyridin-3-yl)pyrrolidin-3-yl]methyl}amino)-4-oxobutanoic acid (CHEBI:234460) has functional parent (−)-3'-AmNic (CHEBI:234410) |
| (±)-3'-AmNic (CHEBI:234408) has part (−)-3'-AmNic (CHEBI:234410) |
| IUPAC Name |
|---|
| 1-[(2S,3R)-1-methyl-2-(pyridin-3-yl)pyrrolidin-3-yl]methanamine |
| Synonyms | Source |
|---|---|
| (−)-trans 3'-aminomethyl nicotine | ChEBI |
| ((2S,3R)-1-methyl-2-(pyridin-3-yl)pyrrolidin-3-yl)methanamine | ChEBI |
| (−)-trans-3'-aminomethylnicotine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:272124-60-4 | PubChem Compound |
| Citations |
|---|