EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17N3 |
| Net Charge | 0 |
| Average Mass | 191.278 |
| Monoisotopic Mass | 191.14225 |
| SMILES | CN1CCC(CN)C1c1cccnc1 |
| InChI | InChI=1S/C11H17N3/c1-14-6-4-9(7-12)11(14)10-3-2-5-13-8-10/h2-3,5,8-9,11H,4,6-7,12H2,1H3 |
| InChIKey | IUMCSWXAFXSTAI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-AmNic (CHEBI:234407) has role hapten (CHEBI:59174) |
| 3'-AmNic (CHEBI:234407) is a N-alkylpyrrolidine (CHEBI:46775) |
| 3'-AmNic (CHEBI:234407) is a primary amino compound (CHEBI:50994) |
| 3'-AmNic (CHEBI:234407) is a pyridines (CHEBI:26421) |
| Incoming Relation(s) |
| (+)-3'-AmNic (CHEBI:234409) is a 3'-AmNic (CHEBI:234407) |
| (−)-3'-AmNic (CHEBI:234410) is a 3'-AmNic (CHEBI:234407) |
| IUPAC Name |
|---|
| 1-[1-methyl-2-(pyridin-3-yl)pyrrolidin-3-yl]methanamine |
| Synonym | Source |
|---|---|
| 3'-aminomethyl nicotine | ChEBI |