EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O3 |
| Net Charge | 0 |
| Average Mass | 344.495 |
| Monoisotopic Mass | 344.23514 |
| SMILES | CCC/C=C\C/C=C\CCCCCCCc1cccc(O)c1C(=O)O |
| InChI | InChI=1S/C22H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h4-5,7-8,15,17-18,23H,2-3,6,9-14,16H2,1H3,(H,24,25)/b5-4-,8-7- |
| InChIKey | KAOMOVYHGLSFHQ-UTOQUPLUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anacardic acid diene (CHEBI:233992) has functional parent salicylic acid (CHEBI:16914) |
| anacardic acid diene (CHEBI:233992) is a hydroxybenzoic acid (CHEBI:24676) |
| Synonym | Source |
|---|---|
| (15:2)-anacardic acid | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| LMPK15040009 | LIPID MAPS |