EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H30O4 |
| Net Charge | -2 |
| Average Mass | 298.423 |
| Monoisotopic Mass | 298.21551 |
| SMILES | CC(CCCC(C)CCC(=O)[O-])CCCC(C)CC(=O)[O-] |
| InChI | InChI=1S/C17H32O4/c1-13(7-5-9-15(3)12-17(20)21)6-4-8-14(2)10-11-16(18)19/h13-15H,4-12H2,1-3H3,(H,18,19)(H,20,21)/p-2 |
| InChIKey | SUNYQAAACVSQIB-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,7,11-trimethyltetradecanedioic acid (CHEBI:233728) has functional parent 3-Methyl-tetradecanedioic acid (CHEBI:165381) |
| 3,7,11-trimethyltetradecanedioic acid (CHEBI:233728) has parent hydride tetradecanedioic acid (CHEBI:76308) |
| 3,7,11-trimethyltetradecanedioic acid (CHEBI:233728) has role human metabolite (CHEBI:77746) |
| 3,7,11-trimethyltetradecanedioic acid (CHEBI:233728) is a dicarboxylic acid anion (CHEBI:35693) |
| 3,7,11-trimethyltetradecanedioic acid (CHEBI:233728) is a methyl-branched fatty acid (CHEBI:62499) |
| Incoming Relation(s) |
| 3,7,11-trimethyltetradecanedioic acid coa (CHEBI:233727) has functional parent 3,7,11-trimethyltetradecanedioic acid (CHEBI:233728) |
| Citations |
|---|