EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H11BrFN3O4 |
| Net Charge | 0 |
| Average Mass | 420.194 |
| Monoisotopic Mass | 418.99170 |
| SMILES | O=C1c2cccn2[C@@]2(CC(O)=NC2=O)C(=O)N1Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C17H11BrFN3O4/c18-10-4-3-9(11(19)6-10)8-21-14(24)12-2-1-5-22(12)17(16(21)26)7-13(23)20-15(17)25/h1-6H,7-8H2,(H,20,23,25)/t17-/m1/s1 |
| InChIKey | QCVNMNYRNIMDKV-QGZVFWFLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 1.1.1.21 (aldehyde reductase) inhibitor An EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that interferes with the action of aldehyde reductase (EC 1.1.1.21). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ranirestat (CHEBI:233577) has role EC 1.1.1.21 (aldehyde reductase) inhibitor (CHEBI:48550) |
| ranirestat (CHEBI:233577) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (3R)-2'-[(4-bromo-2-fluorophenyl)methyl]spiro[pyrrolidine-3,4'-pyrrolo[1,2-a]pyrazine]-1',2,3',5-tetrone |
| Synonyms | Source |
|---|---|
| AS-3201 | SUBMITTER |
| SX-3030 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| D06403 | KEGG DRUG |
| DB05327 | DrugBank |
| https://en.wikipedia.org/wiki/Ranirestat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:147254-64-6 | SUBMITTER |
| Citations |
|---|