EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H30O15 |
| Net Charge | 0 |
| Average Mass | 678.599 |
| Monoisotopic Mass | 678.15847 |
| SMILES | [H]C(=Cc1ccc(O)c(O)c1)C(=O)O[C@@H]1C[C@](O)(C(=O)O)C[C@@H](OC(=O)C([H])=Cc2ccc(O)c(O)c2)[C@H]1OC(=O)C([H])=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C34H30O15/c35-21-7-1-18(13-24(21)38)4-10-29(41)47-27-16-34(46,33(44)45)17-28(48-30(42)11-5-19-2-8-22(36)25(39)14-19)32(27)49-31(43)12-6-20-3-9-23(37)26(40)15-20/h1-15,27-28,32,35-40,46H,16-17H2,(H,44,45)/t27-,28-,32-,34+/m1/s1 |
| InChIKey | OAFXTKGAKYAFSI-UPHZGLEOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | nootropic agent Any compound that improves mental functions such as cognition, memory, intelligence, motivation, attention, and concentration. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4,5-tricaffeoylquinic acid (CHEBI:233498) has functional parent (−)-quinic acid (CHEBI:17521) |
| 3,4,5-tricaffeoylquinic acid (CHEBI:233498) has functional parent caffeic acid (CHEBI:36281) |
| 3,4,5-tricaffeoylquinic acid (CHEBI:233498) has role anti-HIV agent (CHEBI:64946) |
| 3,4,5-tricaffeoylquinic acid (CHEBI:233498) has role anti-inflammatory agent (CHEBI:67079) |
| 3,4,5-tricaffeoylquinic acid (CHEBI:233498) has role antiviral agent (CHEBI:22587) |
| 3,4,5-tricaffeoylquinic acid (CHEBI:233498) has role nootropic agent (CHEBI:66980) |
| 3,4,5-tricaffeoylquinic acid (CHEBI:233498) is a catechols (CHEBI:33566) |
| 3,4,5-tricaffeoylquinic acid (CHEBI:233498) is a cinnamate ester (CHEBI:36087) |
| 3,4,5-tricaffeoylquinic acid (CHEBI:233498) is a cyclitol carboxylic acid (CHEBI:36123) |
| Incoming Relation(s) |
| 3,4,5-tri-(E)-caffeoylquinic acid (CHEBI:233499) is a 3,4,5-tricaffeoylquinic acid (CHEBI:233498) |
| IUPAC Name |
|---|
| (1S,3R,4S,5R)-3,4,5-tris{[3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-1-hydroxycyclohexanecarboxylic acid |
| Synonyms | Source |
|---|---|
| 3,4,5-TCQA | ChEBI |
| 3,4,5-triCQA | ChEBI |
| 3,4,5-tri-O-caffeoylquinic acid | ChEBI |
| Citations |
|---|