EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O6 |
| Net Charge | 0 |
| Average Mass | 396.439 |
| Monoisotopic Mass | 396.15729 |
| SMILES | [H]/C(C(=O)/C([H])=C(\[H])c1ccc(OC)c(OC)c1)=C(O)\C([H])=C(/[H])c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H24O6/c1-26-20-11-7-16(13-22(20)28-3)5-9-18(24)15-19(25)10-6-17-8-12-21(27-2)23(14-17)29-4/h5-15,24H,1-4H3/b9-5+,10-6+,18-15- |
| InChIKey | ZMGUKFHHNQMKJI-CIOHCNBKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| Application: | androgen antagonist A compound which inhibits or antagonises the biosynthesis or actions of androgens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethylcurcumin (CHEBI:233431) has role androgen antagonist (CHEBI:35497) |
| dimethylcurcumin (CHEBI:233431) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (1E,4Z,6E)-1,7-bis(3,4-dimethoxyphenyl)-5-hydroxyhepta-1,4,6-trien-3-one |
| Manual Xrefs | Databases |
|---|---|
| DB06133 | DrugBank |
| https://en.wikipedia.org/wiki/Dimethylcurcumin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:52328-98-0 | SUBMITTER |