EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:233047 - atropine sulfate
| Formula | 2C17H23NO3.H2O4S |
| Net Charge | 0 |
| Average Mass | 676.829 |
| Monoisotopic Mass | 676.30297 |
| SMILES | O=S(=O)(O)O.[H]C1(OC(=O)C([H])(CO)c2ccccc2)C[C@]2([H])CC[C@]([H])(C1)N2C.[H]C1(OC(=O)C([H])(CO)c2ccccc2)C[C@]2([H])CC[C@]([H])(C1)N2C |
| InChI | InChI=1S/2C17H23NO3.H2O4S/c2*1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12;1-5(2,3)4/h2*2-6,13-16,19H,7-11H2,1H3;(H2,1,2,3,4)/t2*13-,14+,15?,16?; |
| InChIKey | HOBWAPHTEJGALG-JKCMADFCSA-N |
| Roles Classification |
|---|
| Biological Role: | muscarinic agonist Any drug that binds to and activates a muscarinic cholinergic receptor. |
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. muscarinic agonist Any drug that binds to and activates a muscarinic cholinergic receptor. antiparkinson drug A drug used in the treatment of Parkinson's disease. antidote to organophosphate poisoning A role borne by a molecule that acts to counteract or neutralise the deleterious effects of organophosphates or acetylcholinesterase inhibitors (nerve agents). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atropine sulfate (CHEBI:233047) has functional parent atropine (CHEBI:16684) |
| atropine sulfate (CHEBI:233047) has role anti-ulcer drug (CHEBI:49201) |
| atropine sulfate (CHEBI:233047) has role antidote to organophosphate poisoning (CHEBI:90753) |
| atropine sulfate (CHEBI:233047) has role antiparkinson drug (CHEBI:48407) |
| atropine sulfate (CHEBI:233047) has role muscarinic agonist (CHEBI:38325) |
| atropine sulfate (CHEBI:233047) has role ophthalmology drug (CHEBI:66981) |
| atropine sulfate (CHEBI:233047) is a organic molecular entity (CHEBI:50860) |
| atropine sulfate (CHEBI:233047) is a racemate (CHEBI:60911) |
| IUPAC Name |
|---|
| [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;sulfuric acid |
| Synonyms | Source |
|---|---|
| Atropine sulfate anhydrous | ChEMBL |
| Atropine sulfate hydrate | ChEMBL |
| Atropine sulfate monohydrate | ChEMBL |
| Atropini sulfas | ChEMBL |
| Atropt | ChEMBL |
| NSC-26671 | ChEMBL |
| Brand Names | Source |
|---|---|
| Atropine sulfate ansyr plastic syringe | ChEMBL |
| Atropine sulfate component of colonaid | ChEMBL |
| Atropine sulfate component of di-atro | ChEMBL |
| Atropine sulfate component of enlon-plus | ChEMBL |
| Atropine sulfate component of logen | ChEMBL |
| Atropine sulfate component of lomanate | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:55-48-1 | SUBMITTER |
| Citations |
|---|