EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C17H23NO3.H2O4S |
| Net Charge | 0 |
| Average Mass | 676.829 |
| Monoisotopic Mass | 676.30297 |
| SMILES | O=S(=O)(O)O.[H]C1(OC(=O)C([H])(CO)c2ccccc2)C[C@]2([H])CC[C@]([H])(C1)N2C.[H]C1(OC(=O)C([H])(CO)c2ccccc2)C[C@]2([H])CC[C@]([H])(C1)N2C |
| InChI | InChI=1S/2C17H23NO3.H2O4S/c2*1-18-13-7-8-14(18)10-15(9-13)21-17(20)16(11-19)12-5-3-2-4-6-12;1-5(2,3)4/h2*2-6,13-16,19H,7-11H2,1H3;(H2,1,2,3,4)/t2*13-,14+,15?,16?; |
| InChIKey | HOBWAPHTEJGALG-JKCMADFCSA-N |
| Roles Classification |
|---|
| Biological Role: | muscarinic agonist Any drug that binds to and activates a muscarinic cholinergic receptor. |
| Application: | muscarinic agonist Any drug that binds to and activates a muscarinic cholinergic receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atropine sulfate (CHEBI:233047) has functional parent atropine (CHEBI:16684) |
| atropine sulfate (CHEBI:233047) has role muscarinic agonist (CHEBI:38325) |
| atropine sulfate (CHEBI:233047) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;sulfuric acid |
| Registry Numbers | Sources |
|---|---|
| CAS:55-48-1 | SUBMITTER |
| Citations |
|---|