EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H39ClN7O2P |
| Net Charge | 0 |
| Average Mass | 584.105 |
| Monoisotopic Mass | 583.25914 |
| SMILES | COc1cc(N2CCC(N3CCN(C)CC3)CC2)ccc1Nc1ncc(Cl)/c(=N/c2ccccc2P(C)(C)=O)n1 |
| InChI | InChI=1S/C29H39ClN7O2P/c1-35-15-17-37(18-16-35)21-11-13-36(14-12-21)22-9-10-24(26(19-22)39-2)33-29-31-20-23(30)28(34-29)32-25-7-5-6-8-27(25)40(3,4)38/h5-10,19-21H,11-18H2,1-4H3,(H2,31,32,33,34) |
| InChIKey | AILRADAXUVEEIR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brigatinib (CHEBI:232810) has role antineoplastic agent (CHEBI:35610) |
| brigatinib (CHEBI:232810) has role tyrosine kinase inhibitor (CHEBI:38637) |
| brigatinib (CHEBI:232810) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]pyrimidine-2,4-diamine |
| Synonym | Source |
|---|---|
| AP26113 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| HMDB0249380 | HMDB |
| D10866 | KEGG DRUG |
| https://en.wikipedia.org/wiki/Brigatinib | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1197953-54-0 | SUBMITTER |
| Citations |
|---|