EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | [H][C@@]12CC[C@H](C(C)C)[C@@]1(C)CC[C@]1(C)C3=C(CC[C@@]21C)[C@@]1(C)C[C@@H](O)[C@H](O)C(C)(C)[C@]1([H])CC3 |
| InChI | InChI=1S/C30H50O2/c1-18(2)19-9-12-24-27(19,5)15-16-29(7)21-10-11-23-26(3,4)25(32)22(31)17-28(23,6)20(21)13-14-30(24,29)8/h18-19,22-25,31-32H,9-17H2,1-8H3/t19-,22-,23+,24-,25+,27-,28-,29-,30+/m1/s1 |
| InChIKey | YOKAJJNTGABJER-QQAKFQOESA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2α-hydroxyisomotiol (CHEBI:232472) has functional parent isomotiol (CHEBI:232471) |
| 2α-hydroxyisomotiol (CHEBI:232472) has role fungal metabolite (CHEBI:76946) |
| 2α-hydroxyisomotiol (CHEBI:232472) is a triterpenoid (CHEBI:36615) |
| UniProt Name | Source |
|---|---|
| 2α-hydroxyisomotiol | UniProt |
| Citations |
|---|