EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | [H][C@@]12CC[C@H](C(C)C)[C@@]1(C)CC[C@]1(C)C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@]1([H])CC3 |
| InChI | InChI=1S/C30H50O/c1-19(2)20-9-12-24-28(20,6)17-18-29(7)22-10-11-23-26(3,4)25(31)14-15-27(23,5)21(22)13-16-30(24,29)8/h19-20,23-25,31H,9-18H2,1-8H3/t20-,23+,24-,25+,27-,28-,29-,30+/m1/s1 |
| InChIKey | LUZUHPHTXSGDDD-PWKXLIGRSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isomotiol (CHEBI:232471) has role fungal metabolite (CHEBI:76946) |
| isomotiol (CHEBI:232471) is a triterpenoid (CHEBI:36615) |
| Incoming Relation(s) |
| 2α-hydroxyisomotiol (CHEBI:232472) has functional parent isomotiol (CHEBI:232471) |
| UniProt Name | Source |
|---|---|
| isomotiol | UniProt |
| Citations |
|---|