EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40O3 |
| Net Charge | 0 |
| Average Mass | 376.581 |
| Monoisotopic Mass | 376.29775 |
| SMILES | [H][C@]1(c2ccc(C(C)(C)CCCCCC)cc2O)C[C@@H](O)CC[C@@H]1CCCO |
| InChI | InChI=1S/C24H40O3/c1-4-5-6-7-14-24(2,3)19-11-13-21(23(27)16-19)22-17-20(26)12-10-18(22)9-8-15-25/h11,13,16,18,20,22,25-27H,4-10,12,14-15,17H2,1-3H3/t18-,20-,22-/m0/s1 |
| InChIKey | YNZFFALZMRAPHQ-VCOUNFBDSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-CP-55940 (CHEBI:232459) is a 2-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-5-(2-methyloctan-2-yl)phenol (CHEBI:91490) |
| (+)-CP-55940 (CHEBI:232459) is enantiomer of (−)-CP-55940 (CHEBI:232353) |
| Incoming Relation(s) |
| (−)-CP-55940 (CHEBI:232353) is enantiomer of (+)-CP-55940 (CHEBI:232459) |
| IUPAC Name |
|---|
| 2-[(1S,2S,5S)-5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-5-(2-methyloctan-2-yl)phenol |
| Synonyms | Source |
|---|---|
| 2-((1S,2S,5S)-5-hydroxy-2-(3-hydroxypropyl)cyclohexyl)-5-(2-methyloctan-2-yl)phenol | ChEBI |
| (+)-CP 55,940 | ChEBI |
| (+)-CP 55940 | ChEBI |
| (+)-CP-55,940 | ChEBI |
| (+)-CP55940 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:83002-05-5 | ChEBI |