EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40O3 |
| Net Charge | 0 |
| Average Mass | 376.581 |
| Monoisotopic Mass | 376.29775 |
| SMILES | [H][C@@]1(c2ccc(C(C)(C)CCCCCC)cc2O)C[C@H](O)CC[C@H]1CCCO |
| InChI | InChI=1S/C24H40O3/c1-4-5-6-7-14-24(2,3)19-11-13-21(23(27)16-19)22-17-20(26)12-10-18(22)9-8-15-25/h11,13,16,18,20,22,25-27H,4-10,12,14-15,17H2,1-3H3/t18-,20-,22-/m1/s1 |
| InChIKey | YNZFFALZMRAPHQ-SYYKKAFVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | CB1 receptor agonist A cannabinoid receptor agonist that binds to and activates type 1 cannabinoid receptors. CB2 receptor agonist A cannabinoid receptor agonist that binds to and activates type 2 cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-CP-55940 (CHEBI:232353) has role CB1 receptor agonist (CHEBI:192269) |
| (−)-CP-55940 (CHEBI:232353) has role CB2 receptor agonist (CHEBI:146246) |
| (−)-CP-55940 (CHEBI:232353) has role neuroprotective agent (CHEBI:63726) |
| (−)-CP-55940 (CHEBI:232353) is a 2-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-5-(2-methyloctan-2-yl)phenol (CHEBI:91490) |
| (−)-CP-55940 (CHEBI:232353) is a synthetic cannabinoid (CHEBI:67201) |
| (−)-CP-55940 (CHEBI:232353) is enantiomer of (+)-CP-55940 (CHEBI:232459) |
| Incoming Relation(s) |
| (+)-CP-55940 (CHEBI:232459) is enantiomer of (−)-CP-55940 (CHEBI:232353) |
| IUPAC Name |
|---|
| 2-[(1R,2R,5R)-5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-5-(2-methyloctan-2-yl)phenol |
| Synonyms | Source |
|---|---|
| 5-(1,1-dimethylheptyl)-2-[(1R,2R,5R)-5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]phenol | ChEBI |
| (−)-CP 55,940 | ChEBI |
| (−)-CP 55940 | ChEBI |
| (−)-CP-55,940 | ChEBI |
| (−)-CP55940 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CP_55,940 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:83002-04-4 | SUBMITTER |
| Citations |
|---|