EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H13F2NO4 |
| Net Charge | 0 |
| Average Mass | 357.312 |
| Monoisotopic Mass | 357.08126 |
| SMILES | O=C(O)c1cn(C2CC2)c2c(F)c(-c3ccc(O)cc3)c(F)cc2c1=O |
| InChI | InChI=1S/C19H13F2NO4/c20-14-7-12-17(16(21)15(14)9-1-5-11(23)6-2-9)22(10-3-4-10)8-13(18(12)24)19(25)26/h1-2,5-8,10,23H,3-4H2,(H,25,26) |
| InChIKey | ISQTYKAFNUVODK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | topoisomerase inhibitor An EC 5.99.1.* (miscellaneous isomerase) inhibitor that interferes with the action of any of the topoisomerases (enzymes that regulate the overwinding or underwinding of DNA). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CP-115953 (CHEBI:232313) has role topoisomerase inhibitor (CHEBI:70727) |
| CP-115953 (CHEBI:232313) is a oxo monocarboxylic acid (CHEBI:35871) |
| CP-115953 (CHEBI:232313) is a phenols (CHEBI:33853) |
| CP-115953 (CHEBI:232313) is a quinolone (CHEBI:23765) |
| IUPAC Name |
|---|
| 1-cyclopropyl-6,8-difluoro-7-(4-hydroxyphenyl)-4-oxoquinoline-3-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:136440-70-5 | SUBMITTER |