EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20N2O5 |
| Net Charge | 0 |
| Average Mass | 260.290 |
| Monoisotopic Mass | 260.13722 |
| SMILES | C/C(=C/C(=O)N(O)CCC[C@H]([NH3+])C(=O)[O-])CCO |
| InChI | InChI=1S/C11H20N2O5/c1-8(4-6-14)7-10(15)13(18)5-2-3-9(12)11(16)17/h7,9,14,18H,2-6,12H2,1H3,(H,16,17)/b8-7-/t9-/m0/s1 |
| InChIKey | WRFIKQWBKYAFNH-FUOZMLNRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fusarinine zwitterion (CHEBI:232308) is a amino-acid zwitterion (CHEBI:35238) |
| fusarinine zwitterion (CHEBI:232308) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| N-acetylfusarinine(1−) (CHEBI:232307) has functional parent fusarinine zwitterion (CHEBI:232308) |
| UniProt Name | Source |
|---|---|
| fusarinine | UniProt |
| Citations |
|---|