EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21N2O6 |
| Net Charge | -1 |
| Average Mass | 301.319 |
| Monoisotopic Mass | 301.14051 |
| SMILES | CC(=O)N[C@@H](CCCN(O)C(=O)/C=C(/C)CCO)C(=O)[O-] |
| InChI | InChI=1S/C13H22N2O6/c1-9(5-7-16)8-12(18)15(21)6-3-4-11(13(19)20)14-10(2)17/h8,11,16,21H,3-7H2,1-2H3,(H,14,17)(H,19,20)/p-1/b9-8-/t11-/m0/s1 |
| InChIKey | FFOKYQQAJYFZKU-IQQGHNRFSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetylfusarinine(1−) (CHEBI:232307) has functional parent fusarinine zwitterion (CHEBI:232308) |
| N-acetylfusarinine(1−) (CHEBI:232307) is a N-acetyl-L-amino acid (CHEBI:21545) |
| UniProt Name | Source |
|---|---|
| N-acetylfusarinine | UniProt |
| Citations |
|---|