EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N4O3 |
| Net Charge | 0 |
| Average Mass | 240.263 |
| Monoisotopic Mass | 240.12224 |
| SMILES | Cn1cnc(C[C@H](NC(=O)CC[NH3+])C(=O)[O-])c1 |
| InChI | InChI=1S/C10H16N4O3/c1-14-5-7(12-6-14)4-8(10(16)17)13-9(15)2-3-11/h5-6,8H,2-4,11H2,1H3,(H,13,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | SLRNWACWRVGMKD-QMMMGPOBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| balenine zwitterion (CHEBI:232060) is a dipeptide zwitterion (CHEBI:90799) |
| balenine zwitterion (CHEBI:232060) is tautomer of Balenine (CHEBI:193825) |
| Incoming Relation(s) |
| Balenine (CHEBI:193825) is tautomer of balenine zwitterion (CHEBI:232060) |
| Synonyms | Source |
|---|---|
| ophidine zwitterion | SUBMITTER |
| β-alanyl-1-methyl-L-histidine zwitterion | SUBMITTER |
| UniProt Name | Source |
|---|---|
| balenine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12186 | MetaCyc |