EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N4O3 |
| Net Charge | 0 |
| Average Mass | 240.263 |
| Monoisotopic Mass | 240.12224 |
| SMILES | Cn1cnc(C[C@H](NC(=O)CCN)C(=O)O)c1 |
| InChI | InChI=1S/C10H16N4O3/c1-14-5-7(12-6-14)4-8(10(16)17)13-9(15)2-3-11/h5-6,8H,2-4,11H2,1H3,(H,13,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | SLRNWACWRVGMKD-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Balenine (CHEBI:193825) is a peptide (CHEBI:16670) |
| Balenine (CHEBI:193825) is tautomer of balenine zwitterion (CHEBI:232060) |
| Incoming Relation(s) |
| balenine zwitterion (CHEBI:232060) is tautomer of Balenine (CHEBI:193825) |
| IUPAC Name |
|---|
| (2S)-2-(3-aminopropanoylamino)-3-(1-methylimidazol-4-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0005769 | HMDB |
| 8374148 | ChemSpider |