EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H39NO6 |
| Net Charge | 0 |
| Average Mass | 389.533 |
| Monoisotopic Mass | 389.27774 |
| SMILES | CCCCCC[C@@H](O)CCCCCC/C=C/[C@H](O)[C@@H](O)[C@H](O)[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C20H39NO6/c1-2-3-4-9-12-15(22)13-10-7-5-6-8-11-14-16(23)18(24)19(25)17(21)20(26)27/h11,14-19,22-25H,2-10,12-13,21H2,1H3,(H,26,27)/b14-11+/t15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | UAPFYKYEEDCCTL-MXSQXUFFSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sphingofungin B zwitterion (CHEBI:231807) is a long-chain fatty acid anion (CHEBI:57560) |
| sphingofungin B zwitterion (CHEBI:231807) is a α-amino-acid zwitterion (CHEBI:78608) |
| sphingofungin B zwitterion (CHEBI:231807) is tautomer of Sphingofungin B (CHEBI:185613) |
| Incoming Relation(s) |
| Sphingofungin B (CHEBI:185613) is tautomer of sphingofungin B zwitterion (CHEBI:231807) |
| UniProt Name | Source |
|---|---|
| sphingofungin B | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-26567 | MetaCyc |
| Citations |
|---|